C38H32Cl2N2O4 — CID 10604293
methyl 4,4-bis[3-chloro-4-(quinolin-2-ylmethoxy)phenyl]pentanoate (PubChem CID 10604293) has the molecular formula C38H32Cl2N2O4 and a molecular weight of 651.59 g/mol. Its IUPAC name is methyl 4,4-bis[3-chloro-4-(quinolin-2-ylmethoxy)phenyl]pentanoate.
| Compound Name | methyl 4,4-bis[3-chloro-4-(quinolin-2-ylmethoxy)phenyl]pentanoate |
|---|---|
| PubChem CID | 10604293 |
| Molecular Formula | C38H32Cl2N2O4 |
| Molecular Weight | 651.59 g/mol |
| Exact Mass | 650.17 |
| IUPAC Name | methyl 4,4-bis[3-chloro-4-(quinolin-2-ylmethoxy)phenyl]pentanoate |
| SMILES | COC(=O)CCC(C)(c1ccc(OCc2ccc3ccccc3n2)c(Cl)c1)c1ccc(OCc2ccc3ccccc3n2)c(Cl)c1 |
| InChI | InChI=1S/C38H32Cl2N2O4/c1-38(20-19-37(43)44-2,27-13-17-35(31(39)21-27)45-23-29-15-11-25-7-3-5-9-33(25)41-29)28-14-18-36(32(40)22-28)46-24-30-16-12-26-8-4-6-10-34(26)42-30/h3-18,21-22H,19-20,23-24H2,1-2H3 |
| InChIKey | POMGIFIOOALRJL-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.59 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |