C36H49N3O6S — CID 10604298
[3-[[(2S,3S)-1-[(3S,4aS,8aS)-3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-acetyloxy-4-phenylsulfanylbutan-2-yl]carbamoyl]-2-methylphenyl] acetate (PubChem CID 10604298) has the molecular formula C36H49N3O6S and a molecular weight of 651.87 g/mol. Its IUPAC name is [3-[[(2S,3S)-1-[(3S,4aS,8aS)-3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-acetyloxy-4-phenylsulfanylbutan-2-yl]carbamoyl]-2-methylphenyl] acetate.
| Compound Name | [3-[[(2S,3S)-1-[(3S,4aS,8aS)-3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-acetyloxy-4-phenylsulfanylbutan-2-yl]carbamoyl]-2-methylphenyl] acetate |
|---|---|
| PubChem CID | 10604298 |
| Molecular Formula | C36H49N3O6S |
| Molecular Weight | 651.87 g/mol |
| Exact Mass | 651.33 |
| IUPAC Name | [3-[[(2S,3S)-1-[(3S,4aS,8aS)-3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-acetyloxy-4-phenylsulfanylbutan-2-yl]carbamoyl]-2-methylphenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)N[C@@H](CN2C[C@H]3CCCC[C@H]3C[C@H]2C(=O)NC(C)(C)C)[C@@H](CSc2ccccc2)OC(C)=O)c1C |
| InChI | InChI=1S/C36H49N3O6S/c1-23-29(17-12-18-32(23)44-24(2)40)34(42)37-30(33(45-25(3)41)22-46-28-15-8-7-9-16-28)21-39-20-27-14-11-10-13-26(27)19-31(39)35(43)38-36(4,5)6/h7-9,12,15-18,26-27,30-31,33H,10-11,13-14,19-22H2,1-6H3,(H,37,42)(H,38,43)/t26-,27+,30-,31-,33+/m0/s1 |
| InChIKey | VPGJGOWCKAOUIM-QZLYUDJUSA-N |
| XLogP | 5.54 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.87 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|