C16H26BrNS — CID 106043282
N-[2-(5-bromothiophen-2-yl)ethyl]-3-(2-methylpropyl)cyclohexan-1-amine (PubChem CID 106043282) has the molecular formula C16H26BrNS and a molecular weight of 344.36 g/mol. Its IUPAC name is N-[2-(5-bromothiophen-2-yl)ethyl]-3-(2-methylpropyl)cyclohexan-1-amine.
| Compound Name | N-[2-(5-bromothiophen-2-yl)ethyl]-3-(2-methylpropyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 106043282 |
| Molecular Formula | C16H26BrNS |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-[2-(5-bromothiophen-2-yl)ethyl]-3-(2-methylpropyl)cyclohexan-1-amine |
| SMILES | CC(C)CC1CCCC(NCCc2ccc(Br)s2)C1 |
| InChI | InChI=1S/C16H26BrNS/c1-12(2)10-13-4-3-5-14(11-13)18-9-8-15-6-7-16(17)19-15/h6-7,12-14,18H,3-5,8-11H2,1-2H3 |
| InChIKey | CHNBIDGNROMQHX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |