C15H18BrNS — CID 106043701
2-(5-bromothiophen-2-yl)-N-[(2,3-dimethylphenyl)methyl]ethanamine (PubChem CID 106043701) has the molecular formula C15H18BrNS and a molecular weight of 324.29 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-N-[(2,3-dimethylphenyl)methyl]ethanamine.
| Compound Name | 2-(5-bromothiophen-2-yl)-N-[(2,3-dimethylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 106043701 |
| Molecular Formula | C15H18BrNS |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-N-[(2,3-dimethylphenyl)methyl]ethanamine |
| SMILES | Cc1cccc(CNCCc2ccc(Br)s2)c1C |
| InChI | InChI=1S/C15H18BrNS/c1-11-4-3-5-13(12(11)2)10-17-9-8-14-6-7-15(16)18-14/h3-7,17H,8-10H2,1-2H3 |
| InChIKey | NZFPKDGHSSPXIB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|