C11H11ClF3N5S — CID 106043835
N-[2-(5-chlorothiophen-2-yl)ethyl]-2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106043835) has the molecular formula C11H11ClF3N5S and a molecular weight of 337.76 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)ethyl]-2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106043835 |
| Molecular Formula | C11H11ClF3N5S |
| Molecular Weight | 337.76 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | NNc1nc(NCCc2ccc(Cl)s2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H11ClF3N5S/c12-8-2-1-6(21-8)3-4-17-9-5-7(11(13,14)15)18-10(19-9)20-16/h1-2,5H,3-4,16H2,(H2,17,18,19,20) |
| InChIKey | CSCMDENDLFJUEG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.76 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|