C11H21N5S — CID 106044130
1-amino-2-(2-methylpropyl)-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine (PubChem CID 106044130) has the molecular formula C11H21N5S and a molecular weight of 255.39 g/mol. Its IUPAC name is 1-amino-2-(2-methylpropyl)-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine.
| Compound Name | 1-amino-2-(2-methylpropyl)-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 106044130 |
| Molecular Formula | C11H21N5S |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 1-amino-2-(2-methylpropyl)-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine |
| SMILES | Cc1nc(CCN/C(=N/CC(C)C)NN)cs1 |
| InChI | InChI=1S/C11H21N5S/c1-8(2)6-14-11(16-12)13-5-4-10-7-17-9(3)15-10/h7-8H,4-6,12H2,1-3H3,(H2,13,14,16) |
| InChIKey | HUOFHGALIXHXQA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|