C9H23N3O2S — CID 106044314
2-[3-[methyl(propan-2-yl)amino]propylamino]ethanesulfonamide (PubChem CID 106044314) has the molecular formula C9H23N3O2S and a molecular weight of 237.37 g/mol. Its IUPAC name is 2-[3-[methyl(propan-2-yl)amino]propylamino]ethanesulfonamide.
| Compound Name | 2-[3-[methyl(propan-2-yl)amino]propylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 106044314 |
| Molecular Formula | C9H23N3O2S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 2-[3-[methyl(propan-2-yl)amino]propylamino]ethanesulfonamide |
| SMILES | CC(C)N(C)CCCNCCS(N)(=O)=O |
| InChI | InChI=1S/C9H23N3O2S/c1-9(2)12(3)7-4-5-11-6-8-15(10,13)14/h9,11H,4-8H2,1-3H3,(H2,10,13,14) |
| InChIKey | VZXDAHXPNCBXMW-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|