C12H25N5O2S2 — CID 106044547
3-amino-N,N-dimethyl-5-[3-[methyl(propan-2-yl)amino]propylamino]-1,2-thiazole-4-sulfonamide (PubChem CID 106044547) has the molecular formula C12H25N5O2S2 and a molecular weight of 335.50 g/mol. Its IUPAC name is 3-amino-N,N-dimethyl-5-[3-[methyl(propan-2-yl)amino]propylamino]-1,2-thiazole-4-sulfonamide.
| Compound Name | 3-amino-N,N-dimethyl-5-[3-[methyl(propan-2-yl)amino]propylamino]-1,2-thiazole-4-sulfonamide |
|---|---|
| PubChem CID | 106044547 |
| Molecular Formula | C12H25N5O2S2 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 3-amino-N,N-dimethyl-5-[3-[methyl(propan-2-yl)amino]propylamino]-1,2-thiazole-4-sulfonamide |
| SMILES | CC(C)N(C)CCCNc1snc(N)c1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C12H25N5O2S2/c1-9(2)17(5)8-6-7-14-12-10(11(13)15-20-12)21(18,19)16(3)4/h9,14H,6-8H2,1-5H3,(H2,13,15) |
| InChIKey | OFTUOLYSQQZZFD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|