C10H13N3O2S — CID 106045753
4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-2,6-dione (PubChem CID 106045753) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is 4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-2,6-dione.
| Compound Name | 4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 106045753 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-2,6-dione |
| SMILES | Cc1nc(CCN2CC(=O)NC(=O)C2)cs1 |
| InChI | InChI=1S/C10H13N3O2S/c1-7-11-8(6-16-7)2-3-13-4-9(14)12-10(15)5-13/h6H,2-5H2,1H3,(H,12,14,15) |
| InChIKey | PFUPVIZHPOTDJW-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|