C12H18ClFN2O2S — CID 106046589
3-(aminomethyl)-5-chloro-2-fluoro-N-pentan-2-ylbenzenesulfonamide (PubChem CID 106046589) has the molecular formula C12H18ClFN2O2S and a molecular weight of 308.81 g/mol. Its IUPAC name is 3-(aminomethyl)-5-chloro-2-fluoro-N-pentan-2-ylbenzenesulfonamide.
| Compound Name | 3-(aminomethyl)-5-chloro-2-fluoro-N-pentan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 106046589 |
| Molecular Formula | C12H18ClFN2O2S |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 3-(aminomethyl)-5-chloro-2-fluoro-N-pentan-2-ylbenzenesulfonamide |
| SMILES | CCCC(C)NS(=O)(=O)c1cc(Cl)cc(CN)c1F |
| InChI | InChI=1S/C12H18ClFN2O2S/c1-3-4-8(2)16-19(17,18)11-6-10(13)5-9(7-15)12(11)14/h5-6,8,16H,3-4,7,15H2,1-2H3 |
| InChIKey | GTHSGEHYRNVJBN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |