C40H45N5O6 — CID 10604664
2-morpholin-4-ylethyl 3-[[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamoylamino]benzoate (PubChem CID 10604664) has the molecular formula C40H45N5O6 and a molecular weight of 691.83 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 3-[[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamoylamino]benzoate.
| Compound Name | 2-morpholin-4-ylethyl 3-[[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 10604664 |
| Molecular Formula | C40H45N5O6 |
| Molecular Weight | 691.83 g/mol |
| Exact Mass | 691.34 |
| IUPAC Name | 2-morpholin-4-ylethyl 3-[[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamoylamino]benzoate |
| SMILES | O=C(Nc1cccc(C(=O)OCCN2CCOCC2)c1)NC1C(=O)N(CC23CC4CC(CC(C4)C2)C3)c2ccccc2N(c2ccccc2)C1=O |
| InChI | InChI=1S/C40H45N5O6/c46-36-35(42-39(49)41-31-8-6-7-30(22-31)38(48)51-18-15-43-13-16-50-17-14-43)37(47)45(32-9-2-1-3-10-32)34-12-5-4-11-33(34)44(36)26-40-23-27-19-28(24-40)21-29(20-27)25-40/h1-12,22,27-29,35H,13-21,23-26H2,(H2,41,42,49) |
| InChIKey | NGIBOVXEDJQVQE-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.83 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|