C41H78O6Si — CID 10604703
methyl (E,15S)-15-[(2S,5S)-5-[(2S,5S)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]oxolan-2-yl]oxolan-2-yl]-15-hydroxypentadec-11-enoate (PubChem CID 10604703) has the molecular formula C41H78O6Si and a molecular weight of 695.15 g/mol. Its IUPAC name is methyl (E,15S)-15-[(2S,5S)-5-[(2S,5S)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]oxolan-2-yl]oxolan-2-yl]-15-hydroxypentadec-11-enoate.
| Compound Name | methyl (E,15S)-15-[(2S,5S)-5-[(2S,5S)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]oxolan-2-yl]oxolan-2-yl]-15-hydroxypentadec-11-enoate |
|---|---|
| PubChem CID | 10604703 |
| Molecular Formula | C41H78O6Si |
| Molecular Weight | 695.15 g/mol |
| Exact Mass | 694.56 |
| IUPAC Name | methyl (E,15S)-15-[(2S,5S)-5-[(2S,5S)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]oxolan-2-yl]oxolan-2-yl]-15-hydroxypentadec-11-enoate |
| SMILES | CCCCCCCCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CC[C@@H]([C@@H]2CC[C@@H]([C@@H](O)CC/C=C/CCCCCCCCCC(=O)OC)O2)O1 |
| InChI | InChI=1S/C41H78O6Si/c1-8-9-10-11-12-19-22-25-28-39(47-48(6,7)41(2,3)4)38-33-32-37(46-38)36-31-30-35(45-36)34(42)27-24-21-18-16-14-13-15-17-20-23-26-29-40(43)44-5/h18,21,34-39,42H,8-17,19-20,22-33H2,1-7H3/b21-18+/t34-,35-,36-,37-,38-,39-/m0/s1 |
| InChIKey | AHIKBYRXWUZAPW-QMMDCDIDSA-N |
| XLogP | 11.38 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.15 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|