C10H23N3O — CID 106047587
(2S)-2-amino-N-[3-[methyl(propan-2-yl)amino]propyl]propanamide (PubChem CID 106047587) has the molecular formula C10H23N3O and a molecular weight of 201.31 g/mol. Its IUPAC name is (2S)-2-amino-N-[3-[methyl(propan-2-yl)amino]propyl]propanamide.
| Compound Name | (2S)-2-amino-N-[3-[methyl(propan-2-yl)amino]propyl]propanamide |
|---|---|
| PubChem CID | 106047587 |
| Molecular Formula | C10H23N3O |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | (2S)-2-amino-N-[3-[methyl(propan-2-yl)amino]propyl]propanamide |
| SMILES | CC(C)N(C)CCCNC(=O)[C@H](C)N |
| InChI | InChI=1S/C10H23N3O/c1-8(2)13(4)7-5-6-12-10(14)9(3)11/h8-9H,5-7,11H2,1-4H3,(H,12,14)/t9-/m0/s1 |
| InChIKey | IGRUQZZSYKAJSI-VIFPVBQESA-N |
| XLogP | 0.18 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|