C41H52O10 — CID 10604800
[(1S,3R,6S,7R,8S)-7-(methoxymethoxy)-1-[(4-methoxyphenyl)methoxymethoxy]-5,5,11,11-tetramethyl-2-oxo-6-(phenylmethoxymethoxy)-3-bicyclo[6.2.1]undecanyl] benzoate (PubChem CID 10604800) has the molecular formula C41H52O10 and a molecular weight of 704.86 g/mol. Its IUPAC name is [(1S,3R,6S,7R,8S)-7-(methoxymethoxy)-1-[(4-methoxyphenyl)methoxymethoxy]-5,5,11,11-tetramethyl-2-oxo-6-(phenylmethoxymethoxy)-3-bicyclo[6.2.1]undecanyl] benzoate.
| Compound Name | [(1S,3R,6S,7R,8S)-7-(methoxymethoxy)-1-[(4-methoxyphenyl)methoxymethoxy]-5,5,11,11-tetramethyl-2-oxo-6-(phenylmethoxymethoxy)-3-bicyclo[6.2.1]undecanyl] benzoate |
|---|---|
| PubChem CID | 10604800 |
| Molecular Formula | C41H52O10 |
| Molecular Weight | 704.86 g/mol |
| Exact Mass | 704.36 |
| IUPAC Name | [(1S,3R,6S,7R,8S)-7-(methoxymethoxy)-1-[(4-methoxyphenyl)methoxymethoxy]-5,5,11,11-tetramethyl-2-oxo-6-(phenylmethoxymethoxy)-3-bicyclo[6.2.1]undecanyl] benzoate |
| SMILES | COCO[C@H]1[C@@H](OCOCc2ccccc2)C(C)(C)C[C@@H](OC(=O)c2ccccc2)C(=O)[C@]2(OCOCc3ccc(OC)cc3)CC[C@H]1C2(C)C |
| InChI | InChI=1S/C41H52O10/c1-39(2)23-34(51-38(43)31-15-11-8-12-16-31)36(42)41(50-28-47-25-30-17-19-32(45-6)20-18-30)22-21-33(40(41,3)4)35(48-26-44-5)37(39)49-27-46-24-29-13-9-7-10-14-29/h7-20,33-35,37H,21-28H2,1-6H3/t33-,34-,35-,37-,41-/m1/s1 |
| InChIKey | YKQKWBXZLLZCFZ-PXDBQEPASA-N |
| XLogP | 7.13 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.86 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|