C41H68O9 — CID 10604803
[(1S)-1-[(2R,5R)-5-[(2R,5R)-5-[(1R)-1-acetyloxy-13-[(2S)-2-methyl-5-oxo-2H-furan-4-yl]-6-oxotridecyl]oxolan-2-yl]oxolan-2-yl]undecyl] acetate (PubChem CID 10604803) has the molecular formula C41H68O9 and a molecular weight of 704.99 g/mol. Its IUPAC name is [(1S)-1-[(2R,5R)-5-[(2R,5R)-5-[(1R)-1-acetyloxy-13-[(2S)-2-methyl-5-oxo-2H-furan-4-yl]-6-oxotridecyl]oxolan-2-yl]oxolan-2-yl]undecyl] acetate.
| Compound Name | [(1S)-1-[(2R,5R)-5-[(2R,5R)-5-[(1R)-1-acetyloxy-13-[(2S)-2-methyl-5-oxo-2H-furan-4-yl]-6-oxotridecyl]oxolan-2-yl]oxolan-2-yl]undecyl] acetate |
|---|---|
| PubChem CID | 10604803 |
| Molecular Formula | C41H68O9 |
| Molecular Weight | 704.99 g/mol |
| Exact Mass | 704.49 |
| IUPAC Name | [(1S)-1-[(2R,5R)-5-[(2R,5R)-5-[(1R)-1-acetyloxy-13-[(2S)-2-methyl-5-oxo-2H-furan-4-yl]-6-oxotridecyl]oxolan-2-yl]oxolan-2-yl]undecyl] acetate |
| SMILES | CCCCCCCCCC[C@H](OC(C)=O)[C@H]1CC[C@H]([C@H]2CC[C@H]([C@@H](CCCCC(=O)CCCCCCCC3=C[C@H](C)OC3=O)OC(C)=O)O2)O1 |
| InChI | InChI=1S/C41H68O9/c1-5-6-7-8-9-10-14-17-23-35(47-31(3)42)37-25-27-39(49-37)40-28-26-38(50-40)36(48-32(4)43)24-19-18-22-34(44)21-16-13-11-12-15-20-33-29-30(2)46-41(33)45/h29-30,35-40H,5-28H2,1-4H3/t30-,35-,36+,37+,38+,39+,40+/m0/s1 |
| InChIKey | CGFDEIVYPVQMAB-MWYOCWFYSA-N |
| XLogP | 9.21 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.99 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|