C12H13ClN2O4S — CID 106048091
5-(aminomethyl)-N-(3-chloro-4-methoxyphenyl)furan-2-sulfonamide (PubChem CID 106048091) has the molecular formula C12H13ClN2O4S and a molecular weight of 316.77 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(3-chloro-4-methoxyphenyl)furan-2-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(3-chloro-4-methoxyphenyl)furan-2-sulfonamide |
|---|---|
| PubChem CID | 106048091 |
| Molecular Formula | C12H13ClN2O4S |
| Molecular Weight | 316.77 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 5-(aminomethyl)-N-(3-chloro-4-methoxyphenyl)furan-2-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(CN)o2)cc1Cl |
| InChI | InChI=1S/C12H13ClN2O4S/c1-18-11-4-2-8(6-10(11)13)15-20(16,17)12-5-3-9(7-14)19-12/h2-6,15H,7,14H2,1H3 |
| InChIKey | FQKGAVLVTJVARQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.77 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |