C14H25N5O — CID 106050219
6-(ethylamino)-N-[3-[methyl(propan-2-yl)amino]propyl]pyrazine-2-carboxamide (PubChem CID 106050219) has the molecular formula C14H25N5O and a molecular weight of 279.39 g/mol. Its IUPAC name is 6-(ethylamino)-N-[3-[methyl(propan-2-yl)amino]propyl]pyrazine-2-carboxamide.
| Compound Name | 6-(ethylamino)-N-[3-[methyl(propan-2-yl)amino]propyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 106050219 |
| Molecular Formula | C14H25N5O |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | 6-(ethylamino)-N-[3-[methyl(propan-2-yl)amino]propyl]pyrazine-2-carboxamide |
| SMILES | CCNc1cncc(C(=O)NCCCN(C)C(C)C)n1 |
| InChI | InChI=1S/C14H25N5O/c1-5-16-13-10-15-9-12(18-13)14(20)17-7-6-8-19(4)11(2)3/h9-11H,5-8H2,1-4H3,(H,16,18)(H,17,20) |
| InChIKey | NQBOTPWXFNAYIF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|