C21H22F21N2O4P — CID 10605337
4-[4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluorotridecoxy(morpholin-4-yl)phosphoryl]morpholine (PubChem CID 10605337) has the molecular formula C21H22F21N2O4P and a molecular weight of 796.35 g/mol. Its IUPAC name is 4-[4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluorotridecoxy(morpholin-4-yl)phosphoryl]morpholine.
| Compound Name | 4-[4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluorotridecoxy(morpholin-4-yl)phosphoryl]morpholine |
|---|---|
| PubChem CID | 10605337 |
| Molecular Formula | C21H22F21N2O4P |
| Molecular Weight | 796.35 g/mol |
| Exact Mass | 796.10 |
| IUPAC Name | 4-[4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluorotridecoxy(morpholin-4-yl)phosphoryl]morpholine |
| SMILES | O=P(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C21H22F21N2O4P/c22-12(23,2-1-7-48-49(45,43-3-8-46-9-4-43)44-5-10-47-11-6-44)13(24,25)14(26,27)15(28,29)16(30,31)17(32,33)18(34,35)19(36,37)20(38,39)21(40,41)42/h1-11H2 |
| InChIKey | ZDRWTFQHDXNOEF-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.35 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|