C44H66O12Si — CID 10605424
tritert-butyl (1S,3S,4S,5R,6R,7R)-1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-hydroxy-6,7-bis(phenylmethoxy)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate (PubChem CID 10605424) has the molecular formula C44H66O12Si and a molecular weight of 815.09 g/mol. Its IUPAC name is tritert-butyl (1S,3S,4S,5R,6R,7R)-1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-hydroxy-6,7-bis(phenylmethoxy)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate.
| Compound Name | tritert-butyl (1S,3S,4S,5R,6R,7R)-1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-hydroxy-6,7-bis(phenylmethoxy)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 10605424 |
| Molecular Formula | C44H66O12Si |
| Molecular Weight | 815.09 g/mol |
| Exact Mass | 814.43 |
| IUPAC Name | tritert-butyl (1S,3S,4S,5R,6R,7R)-1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-hydroxy-6,7-bis(phenylmethoxy)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1O[C@@]2(CCCO[Si](C)(C)C(C)(C)C)O[C@](C(=O)OC(C)(C)C)([C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)[C@]1(O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C44H66O12Si/c1-38(2,3)53-35(45)34-43(48,36(46)54-39(4,5)6)44(37(47)55-40(7,8)9)33(50-29-31-24-19-16-20-25-31)32(49-28-30-22-17-15-18-23-30)42(52-34,56-44)26-21-27-51-57(13,14)41(10,11)12/h15-20,22-25,32-34,48H,21,26-29H2,1-14H3/t32-,33-,34-,42+,43-,44+/m1/s1 |
| InChIKey | ZYBGLCKRQNTICQ-MICOBWOISA-N |
| XLogP | 7.58 |
| TPSA | 145.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.09 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|