C12H14Cl2N4O2S — CID 106058989
N-(3,5-dichlorophenyl)-4-(ethylaminomethyl)-1H-pyrazole-5-sulfonamide (PubChem CID 106058989) has the molecular formula C12H14Cl2N4O2S and a molecular weight of 349.24 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-4-(ethylaminomethyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(3,5-dichlorophenyl)-4-(ethylaminomethyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106058989 |
| Molecular Formula | C12H14Cl2N4O2S |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | N-(3,5-dichlorophenyl)-4-(ethylaminomethyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CCNCc1cn[nH]c1S(=O)(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2N4O2S/c1-2-15-6-8-7-16-17-12(8)21(19,20)18-11-4-9(13)3-10(14)5-11/h3-5,7,15,18H,2,6H2,1H3,(H,16,17) |
| InChIKey | URXXYDZHOMANFS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |