C14H22ClFN2O2S — CID 106059219
5-chloro-3-(ethylaminomethyl)-2-fluoro-N-(3-methylbutyl)benzenesulfonamide (PubChem CID 106059219) has the molecular formula C14H22ClFN2O2S and a molecular weight of 336.86 g/mol. Its IUPAC name is 5-chloro-3-(ethylaminomethyl)-2-fluoro-N-(3-methylbutyl)benzenesulfonamide.
| Compound Name | 5-chloro-3-(ethylaminomethyl)-2-fluoro-N-(3-methylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106059219 |
| Molecular Formula | C14H22ClFN2O2S |
| Molecular Weight | 336.86 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 5-chloro-3-(ethylaminomethyl)-2-fluoro-N-(3-methylbutyl)benzenesulfonamide |
| SMILES | CCNCc1cc(Cl)cc(S(=O)(=O)NCCC(C)C)c1F |
| InChI | InChI=1S/C14H22ClFN2O2S/c1-4-17-9-11-7-12(15)8-13(14(11)16)21(19,20)18-6-5-10(2)3/h7-8,10,17-18H,4-6,9H2,1-3H3 |
| InChIKey | QDFAOBDQOIXQIF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.86 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |