C13H11F3N2O2S — CID 106060049
4-(aminomethyl)-N-(3,4-difluorophenyl)-2-fluorobenzenesulfonamide (PubChem CID 106060049) has the molecular formula C13H11F3N2O2S and a molecular weight of 316.30 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(3,4-difluorophenyl)-2-fluorobenzenesulfonamide.
| Compound Name | 4-(aminomethyl)-N-(3,4-difluorophenyl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 106060049 |
| Molecular Formula | C13H11F3N2O2S |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 4-(aminomethyl)-N-(3,4-difluorophenyl)-2-fluorobenzenesulfonamide |
| SMILES | NCc1ccc(S(=O)(=O)Nc2ccc(F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C13H11F3N2O2S/c14-10-3-2-9(6-11(10)15)18-21(19,20)13-4-1-8(7-17)5-12(13)16/h1-6,18H,7,17H2 |
| InChIKey | PPWGFXCLVFTJOP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |