C13H11Cl2FN2O2S — CID 106060630
5-(aminomethyl)-2,4-dichloro-N-(3-fluorophenyl)benzenesulfonamide (PubChem CID 106060630) has the molecular formula C13H11Cl2FN2O2S and a molecular weight of 349.21 g/mol. Its IUPAC name is 5-(aminomethyl)-2,4-dichloro-N-(3-fluorophenyl)benzenesulfonamide.
| Compound Name | 5-(aminomethyl)-2,4-dichloro-N-(3-fluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106060630 |
| Molecular Formula | C13H11Cl2FN2O2S |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | 5-(aminomethyl)-2,4-dichloro-N-(3-fluorophenyl)benzenesulfonamide |
| SMILES | NCc1cc(S(=O)(=O)Nc2cccc(F)c2)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H11Cl2FN2O2S/c14-11-6-12(15)13(4-8(11)7-17)21(19,20)18-10-3-1-2-9(16)5-10/h1-6,18H,7,17H2 |
| InChIKey | NUQUVPUYXMUYSB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |