C68H75BrN4Ni — CID 10606142
5-(4-bromophenyl)-10,15,20-tris(3,5-ditert-butylphenyl)porphyrin-22,24-diide;nickel(2+) (PubChem CID 10606142) has the molecular formula C68H75BrN4Ni and a molecular weight of 1086.97 g/mol. Its IUPAC name is 5-(4-bromophenyl)-10,15,20-tris(3,5-ditert-butylphenyl)porphyrin-22,24-diide;nickel(2+).
| Compound Name | 5-(4-bromophenyl)-10,15,20-tris(3,5-ditert-butylphenyl)porphyrin-22,24-diide;nickel(2+) |
|---|---|
| PubChem CID | 10606142 |
| Molecular Formula | C68H75BrN4Ni |
| Molecular Weight | 1086.97 g/mol |
| Exact Mass | 1084.45 |
| IUPAC Name | 5-(4-bromophenyl)-10,15,20-tris(3,5-ditert-butylphenyl)porphyrin-22,24-diide;nickel(2+) |
| SMILES | CC(C)(C)c1cc(-c2c3nc(c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4ccc([n-]4)c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4nc(c(-c5ccc(Br)cc5)c5ccc2[n-]5)C=C4)C=C3)cc(C(C)(C)C)c1.[Ni+2] |
| InChI | InChI=1S/C68H75BrN4.Ni/c1-63(2,3)44-31-41(32-45(37-44)64(4,5)6)60-53-25-23-51(70-53)59(40-19-21-50(69)22-20-40)52-24-26-54(71-52)61(42-33-46(65(7,8)9)38-47(34-42)66(10,11)12)56-28-30-58(73-56)62(57-29-27-55(60)72-57)43-35-48(67(13,14)15)39-49(36-43)68(16,17)18;/h19-39H,1-18H3;/q-2;+2/b59-51-,59-52-,60-53-,60-55-,61-54-,61-56-,62-57-,62-58-; |
| InChIKey | CWOVSPJRKGWGPR-FBIDIKIQSA-N |
| XLogP | 19.13 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1086.97 |
| LogP ≤ 5 | 19.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |