C14H19N3O2S2 — CID 106063105
5-[2-(ethylamino)ethyl]-N-(4-methyl-3-pyridinyl)thiophene-2-sulfonamide (PubChem CID 106063105) has the molecular formula C14H19N3O2S2 and a molecular weight of 325.46 g/mol. Its IUPAC name is 5-[2-(ethylamino)ethyl]-N-(4-methyl-3-pyridinyl)thiophene-2-sulfonamide.
| Compound Name | 5-[2-(ethylamino)ethyl]-N-(4-methyl-3-pyridinyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106063105 |
| Molecular Formula | C14H19N3O2S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 5-[2-(ethylamino)ethyl]-N-(4-methyl-3-pyridinyl)thiophene-2-sulfonamide |
| SMILES | CCNCCc1ccc(S(=O)(=O)Nc2cnccc2C)s1 |
| InChI | InChI=1S/C14H19N3O2S2/c1-3-15-9-7-12-4-5-14(20-12)21(18,19)17-13-10-16-8-6-11(13)2/h4-6,8,10,15,17H,3,7,9H2,1-2H3 |
| InChIKey | YRQGCIVQWKADDA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|