C15H24N2O3S — CID 106065308
2,3-dimethyl-5-(methylaminomethyl)-N-(oxan-3-yl)benzenesulfonamide (PubChem CID 106065308) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 2,3-dimethyl-5-(methylaminomethyl)-N-(oxan-3-yl)benzenesulfonamide.
| Compound Name | 2,3-dimethyl-5-(methylaminomethyl)-N-(oxan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106065308 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2,3-dimethyl-5-(methylaminomethyl)-N-(oxan-3-yl)benzenesulfonamide |
| SMILES | CNCc1cc(C)c(C)c(S(=O)(=O)NC2CCCOC2)c1 |
| InChI | InChI=1S/C15H24N2O3S/c1-11-7-13(9-16-3)8-15(12(11)2)21(18,19)17-14-5-4-6-20-10-14/h7-8,14,16-17H,4-6,9-10H2,1-3H3 |
| InChIKey | MOVZRDVAKILQJU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |