C12H25N3O2S — CID 106065679
4-(aminomethyl)-N-(1-cyclopropylpropan-2-yl)piperidine-1-sulfonamide (PubChem CID 106065679) has the molecular formula C12H25N3O2S and a molecular weight of 275.42 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(1-cyclopropylpropan-2-yl)piperidine-1-sulfonamide.
| Compound Name | 4-(aminomethyl)-N-(1-cyclopropylpropan-2-yl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106065679 |
| Molecular Formula | C12H25N3O2S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 4-(aminomethyl)-N-(1-cyclopropylpropan-2-yl)piperidine-1-sulfonamide |
| SMILES | CC(CC1CC1)NS(=O)(=O)N1CCC(CN)CC1 |
| InChI | InChI=1S/C12H25N3O2S/c1-10(8-11-2-3-11)14-18(16,17)15-6-4-12(9-13)5-7-15/h10-12,14H,2-9,13H2,1H3 |
| InChIKey | GJKRNXQSKGEKHW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |