C15H18N2O — CID 10606610
4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazin-2-yl]benzonitrile (PubChem CID 10606610) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is 4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazin-2-yl]benzonitrile.
| Compound Name | 4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 10606610 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazin-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(C2NC[C@H]3CCCC[C@@H]3O2)cc1 |
| InChI | InChI=1S/C15H18N2O/c16-9-11-5-7-12(8-6-11)15-17-10-13-3-1-2-4-14(13)18-15/h5-8,13-15,17H,1-4,10H2/t13-,14+,15?/m1/s1 |
| InChIKey | CVORWLFZJIYMJW-GNXJLENFSA-N |
| XLogP | 2.74 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |