C30H46O3 — CID 10606663
2-[(5E)-5-[(4E,8E,12E)-4,9,13,17-tetramethyloctadeca-4,8,12,16-tetraenylidene]oxan-2-yl]prop-2-enoic acid (PubChem CID 10606663) has the molecular formula C30H46O3 and a molecular weight of 454.70 g/mol. Its IUPAC name is 2-[(5E)-5-[(4E,8E,12E)-4,9,13,17-tetramethyloctadeca-4,8,12,16-tetraenylidene]oxan-2-yl]prop-2-enoic acid.
| Compound Name | 2-[(5E)-5-[(4E,8E,12E)-4,9,13,17-tetramethyloctadeca-4,8,12,16-tetraenylidene]oxan-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 10606663 |
| Molecular Formula | C30H46O3 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | 2-[(5E)-5-[(4E,8E,12E)-4,9,13,17-tetramethyloctadeca-4,8,12,16-tetraenylidene]oxan-2-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)C1CC/C(=C\CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)CO1 |
| InChI | InChI=1S/C30H46O3/c1-23(2)12-9-15-26(5)17-10-16-24(3)13-7-8-14-25(4)18-11-19-28-20-21-29(33-22-28)27(6)30(31)32/h12-14,17,19,29H,6-11,15-16,18,20-22H2,1-5H3,(H,31,32)/b24-13+,25-14+,26-17+,28-19+ |
| InChIKey | HJNULIFEXQNJKQ-CLSKUNCMSA-N |
| XLogP | 8.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|