C26H31N3O5 — CID 10606670
3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-6,7-dimethoxy-1-methylquinazoline-2,4-dione (PubChem CID 10606670) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is 3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-6,7-dimethoxy-1-methylquinazoline-2,4-dione.
| Compound Name | 3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-6,7-dimethoxy-1-methylquinazoline-2,4-dione |
|---|---|
| PubChem CID | 10606670 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-6,7-dimethoxy-1-methylquinazoline-2,4-dione |
| SMILES | COc1cc2c(=O)n(CCN3C[C@@H]4CCc5c(OC)cccc5[C@@H]4C3)c(=O)n(C)c2cc1OC |
| InChI | InChI=1S/C26H31N3O5/c1-27-21-13-24(34-4)23(33-3)12-19(21)25(30)29(26(27)31)11-10-28-14-16-8-9-18-17(20(16)15-28)6-5-7-22(18)32-2/h5-7,12-13,16,20H,8-11,14-15H2,1-4H3/t16-,20+/m0/s1 |
| InChIKey | UEDODQFERYKFQS-OXJNMPFZSA-N |
| XLogP | 2.39 |
| TPSA | 74.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |