About N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-4-(methylamino)butane-1-sulfonamide
N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-4-(methylamino)butane-1-sulfonamide (PubChem CID 106066893) has the molecular formula C11H15ClN4O2S2
and a molecular weight of 334.85 g/mol. Its IUPAC name is N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-4-(methylamino)butane-1-sulfonamide.
Molecular Properties
| Compound Name | N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-4-(methylamino)butane-1-sulfonamide |
| PubChem CID | 106066893 |
| Molecular Formula | C11H15ClN4O2S2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-4-(methylamino)butane-1-sulfonamide |
| SMILES | CNCCCCS(=O)(=O)Nc1c(Cl)ccc2nsnc12 |
| InChI | InChI=1S/C11H15ClN4O2S2/c1-13-6-2-3-7-20(17,18)16-10-8(12)4-5-9-11(10)15-19-14-9/h4-5,13,16H,2-3,6-7H2,1H3 |
| InChIKey | DBFVGJPQLBTFDW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-4-(methylamino)butane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-4-(methylamino)butane-1-sulfonamide?
The IUPAC name of N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-4-(methylamino)butane-1-sulfonamide (CID 106066893) is N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-4-(methylamino)butane-1-sulfonamide.
What is the SMILES notation for N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-4-(methylamino)butane-1-sulfonamide?
The canonical SMILES for N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-4-(methylamino)butane-1-sulfonamide is CNCCCCS(=O)(=O)Nc1c(Cl)ccc2nsnc12.
What is the InChIKey of N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-4-(methylamino)butane-1-sulfonamide?
The InChIKey is DBFVGJPQLBTFDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClN4O2S2/c1-13-6-2-3-7-20(17,18)16-10-8(12)4-5-9-11(10)15-19-14-9/h4-5,13,16H,2-3,6-7H2,1H3.
What are the key properties of N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-4-(methylamino)butane-1-sulfonamide?
N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-4-(methylamino)butane-1-sulfonamide has a molecular weight of 334.85 g/mol, XLogP of 2.09, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-4-(methylamino)butane-1-sulfonamide is sourced from PubChem (CID 106066893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).