C4H7NO2 — CID 10606705
(3R,4S)-3,4-dihydro-2H-pyrrole-3,4-diol (PubChem CID 10606705) has the molecular formula C4H7NO2 and a molecular weight of 101.10 g/mol. Its IUPAC name is (3R,4S)-3,4-dihydro-2H-pyrrole-3,4-diol.
| Compound Name | (3R,4S)-3,4-dihydro-2H-pyrrole-3,4-diol |
|---|---|
| PubChem CID | 10606705 |
| Molecular Formula | C4H7NO2 |
| Molecular Weight | 101.10 g/mol |
| Exact Mass | 101.05 |
| IUPAC Name | (3R,4S)-3,4-dihydro-2H-pyrrole-3,4-diol |
| SMILES | O[C@@H]1CN=C[C@@H]1O |
| InChI | InChI=1S/C4H7NO2/c6-3-1-5-2-4(3)7/h1,3-4,6-7H,2H2/t3-,4+/m0/s1 |
| InChIKey | RTVUDPFAUMGQAC-IUYQGCFVSA-N |
| XLogP | -1.21 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 101.10 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |