C13H15BrN2O3S2 — CID 106067208
N-(2-bromo-5-methoxyphenyl)-4-(methylaminomethyl)thiophene-2-sulfonamide (PubChem CID 106067208) has the molecular formula C13H15BrN2O3S2 and a molecular weight of 391.31 g/mol. Its IUPAC name is N-(2-bromo-5-methoxyphenyl)-4-(methylaminomethyl)thiophene-2-sulfonamide.
| Compound Name | N-(2-bromo-5-methoxyphenyl)-4-(methylaminomethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106067208 |
| Molecular Formula | C13H15BrN2O3S2 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 389.97 |
| IUPAC Name | N-(2-bromo-5-methoxyphenyl)-4-(methylaminomethyl)thiophene-2-sulfonamide |
| SMILES | CNCc1csc(S(=O)(=O)Nc2cc(OC)ccc2Br)c1 |
| InChI | InChI=1S/C13H15BrN2O3S2/c1-15-7-9-5-13(20-8-9)21(17,18)16-12-6-10(19-2)3-4-11(12)14/h3-6,8,15-16H,7H2,1-2H3 |
| InChIKey | VAOAFSJZRGNIPT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |