C14H26N2O3S2 — CID 106067648
N-(4-methoxybutan-2-yl)-4-methyl-5-(propylaminomethyl)thiophene-2-sulfonamide (PubChem CID 106067648) has the molecular formula C14H26N2O3S2 and a molecular weight of 334.51 g/mol. Its IUPAC name is N-(4-methoxybutan-2-yl)-4-methyl-5-(propylaminomethyl)thiophene-2-sulfonamide.
| Compound Name | N-(4-methoxybutan-2-yl)-4-methyl-5-(propylaminomethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106067648 |
| Molecular Formula | C14H26N2O3S2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | N-(4-methoxybutan-2-yl)-4-methyl-5-(propylaminomethyl)thiophene-2-sulfonamide |
| SMILES | CCCNCc1sc(S(=O)(=O)NC(C)CCOC)cc1C |
| InChI | InChI=1S/C14H26N2O3S2/c1-5-7-15-10-13-11(2)9-14(20-13)21(17,18)16-12(3)6-8-19-4/h9,12,15-16H,5-8,10H2,1-4H3 |
| InChIKey | XCNIBVRIMBZDBJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|