About (E)-4-ethynyloct-4-ene
(E)-4-ethynyloct-4-ene (PubChem CID 10606792) has the molecular formula C10H16
and a molecular weight of 136.24 g/mol. Its IUPAC name is (E)-4-ethynyloct-4-ene.
Molecular Properties
| Compound Name | (E)-4-ethynyloct-4-ene |
| PubChem CID | 10606792 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | (E)-4-ethynyloct-4-ene |
| SMILES | C#C/C(=C/CCC)CCC |
| InChI | InChI=1S/C10H16/c1-4-7-9-10(6-3)8-5-2/h3,9H,4-5,7-8H2,1-2H3/b10-9- |
| InChIKey | UKBFOLTWUZMZKM-KTKRTIGZSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-ethynyloct-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-ethynyloct-4-ene?
The IUPAC name of (E)-4-ethynyloct-4-ene (CID 10606792) is (E)-4-ethynyloct-4-ene.
What is the SMILES notation for (E)-4-ethynyloct-4-ene?
The canonical SMILES for (E)-4-ethynyloct-4-ene is C#C/C(=C/CCC)CCC.
What is the InChIKey of (E)-4-ethynyloct-4-ene?
The InChIKey is UKBFOLTWUZMZKM-KTKRTIGZSA-N. The full InChI is InChI=1S/C10H16/c1-4-7-9-10(6-3)8-5-2/h3,9H,4-5,7-8H2,1-2H3/b10-9-.
What are the key properties of (E)-4-ethynyloct-4-ene?
(E)-4-ethynyloct-4-ene has a molecular weight of 136.24 g/mol, XLogP of 3.15, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-ethynyloct-4-ene is sourced from PubChem (CID 10606792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).