About 2-prop-1-en-2-yl-2,3-dihydrofuran-4-carbaldehyde
2-prop-1-en-2-yl-2,3-dihydrofuran-4-carbaldehyde (PubChem CID 10606803) has the molecular formula C8H10O2
and a molecular weight of 138.17 g/mol. Its IUPAC name is 2-prop-1-en-2-yl-2,3-dihydrofuran-4-carbaldehyde.
Molecular Properties
| Compound Name | 2-prop-1-en-2-yl-2,3-dihydrofuran-4-carbaldehyde |
| PubChem CID | 10606803 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 2-prop-1-en-2-yl-2,3-dihydrofuran-4-carbaldehyde |
| SMILES | C=C(C)C1CC(C=O)=CO1 |
| InChI | InChI=1S/C8H10O2/c1-6(2)8-3-7(4-9)5-10-8/h4-5,8H,1,3H2,2H3 |
| InChIKey | OHURMDRQNGOUSR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-1-en-2-yl-2,3-dihydrofuran-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-1-en-2-yl-2,3-dihydrofuran-4-carbaldehyde?
The IUPAC name of 2-prop-1-en-2-yl-2,3-dihydrofuran-4-carbaldehyde (CID 10606803) is 2-prop-1-en-2-yl-2,3-dihydrofuran-4-carbaldehyde.
What is the SMILES notation for 2-prop-1-en-2-yl-2,3-dihydrofuran-4-carbaldehyde?
The canonical SMILES for 2-prop-1-en-2-yl-2,3-dihydrofuran-4-carbaldehyde is C=C(C)C1CC(C=O)=CO1.
What is the InChIKey of 2-prop-1-en-2-yl-2,3-dihydrofuran-4-carbaldehyde?
The InChIKey is OHURMDRQNGOUSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2/c1-6(2)8-3-7(4-9)5-10-8/h4-5,8H,1,3H2,2H3.
What are the key properties of 2-prop-1-en-2-yl-2,3-dihydrofuran-4-carbaldehyde?
2-prop-1-en-2-yl-2,3-dihydrofuran-4-carbaldehyde has a molecular weight of 138.17 g/mol, XLogP of 1.43, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-1-en-2-yl-2,3-dihydrofuran-4-carbaldehyde is sourced from PubChem (CID 10606803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).