About 1,6-dimethylpyrimidine-2,4-dione
1,6-dimethylpyrimidine-2,4-dione (PubChem CID 10606818) has the molecular formula C6H8N2O2
and a molecular weight of 140.14 g/mol. Its IUPAC name is 1,6-dimethylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1,6-dimethylpyrimidine-2,4-dione |
| PubChem CID | 10606818 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 1,6-dimethylpyrimidine-2,4-dione |
| SMILES | Cc1cc(=O)[nH]c(=O)n1C |
| InChI | InChI=1S/C6H8N2O2/c1-4-3-5(9)7-6(10)8(4)2/h3H,1-2H3,(H,7,9,10) |
| InChIKey | OCUWGDBSGJMUNG-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,6-dimethylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dimethylpyrimidine-2,4-dione?
The IUPAC name of 1,6-dimethylpyrimidine-2,4-dione (CID 10606818) is 1,6-dimethylpyrimidine-2,4-dione.
What is the SMILES notation for 1,6-dimethylpyrimidine-2,4-dione?
The canonical SMILES for 1,6-dimethylpyrimidine-2,4-dione is Cc1cc(=O)[nH]c(=O)n1C.
What is the InChIKey of 1,6-dimethylpyrimidine-2,4-dione?
The InChIKey is OCUWGDBSGJMUNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2/c1-4-3-5(9)7-6(10)8(4)2/h3H,1-2H3,(H,7,9,10).
What are the key properties of 1,6-dimethylpyrimidine-2,4-dione?
1,6-dimethylpyrimidine-2,4-dione has a molecular weight of 140.14 g/mol, XLogP of -0.62, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dimethylpyrimidine-2,4-dione is sourced from PubChem (CID 10606818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).