C13H24N2O3S2 — CID 106068260
N-(1-methoxybutan-2-yl)-2-[(propan-2-ylamino)methyl]thiophene-3-sulfonamide (PubChem CID 106068260) has the molecular formula C13H24N2O3S2 and a molecular weight of 320.48 g/mol. Its IUPAC name is N-(1-methoxybutan-2-yl)-2-[(propan-2-ylamino)methyl]thiophene-3-sulfonamide.
| Compound Name | N-(1-methoxybutan-2-yl)-2-[(propan-2-ylamino)methyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106068260 |
| Molecular Formula | C13H24N2O3S2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | N-(1-methoxybutan-2-yl)-2-[(propan-2-ylamino)methyl]thiophene-3-sulfonamide |
| SMILES | CCC(COC)NS(=O)(=O)c1ccsc1CNC(C)C |
| InChI | InChI=1S/C13H24N2O3S2/c1-5-11(9-18-4)15-20(16,17)13-6-7-19-12(13)8-14-10(2)3/h6-7,10-11,14-15H,5,8-9H2,1-4H3 |
| InChIKey | BECQWXJLZDKKTN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |