About 3-(aminomethyl)-N,N-dimethyloxolan-3-amine
3-(aminomethyl)-N,N-dimethyloxolan-3-amine (PubChem CID 10606872) has the molecular formula C7H16N2O
and a molecular weight of 144.22 g/mol. Its IUPAC name is 3-(aminomethyl)-N,N-dimethyloxolan-3-amine.
Molecular Properties
| Compound Name | 3-(aminomethyl)-N,N-dimethyloxolan-3-amine |
| PubChem CID | 10606872 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | 3-(aminomethyl)-N,N-dimethyloxolan-3-amine |
| SMILES | CN(C)C1(CN)CCOC1 |
| InChI | InChI=1S/C7H16N2O/c1-9(2)7(5-8)3-4-10-6-7/h3-6,8H2,1-2H3 |
| InChIKey | PPASVTTXWXCGDO-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(aminomethyl)-N,N-dimethyloxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-N,N-dimethyloxolan-3-amine?
The IUPAC name of 3-(aminomethyl)-N,N-dimethyloxolan-3-amine (CID 10606872) is 3-(aminomethyl)-N,N-dimethyloxolan-3-amine.
What is the SMILES notation for 3-(aminomethyl)-N,N-dimethyloxolan-3-amine?
The canonical SMILES for 3-(aminomethyl)-N,N-dimethyloxolan-3-amine is CN(C)C1(CN)CCOC1.
What is the InChIKey of 3-(aminomethyl)-N,N-dimethyloxolan-3-amine?
The InChIKey is PPASVTTXWXCGDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O/c1-9(2)7(5-8)3-4-10-6-7/h3-6,8H2,1-2H3.
What are the key properties of 3-(aminomethyl)-N,N-dimethyloxolan-3-amine?
3-(aminomethyl)-N,N-dimethyloxolan-3-amine has a molecular weight of 144.22 g/mol, XLogP of -0.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-N,N-dimethyloxolan-3-amine is sourced from PubChem (CID 10606872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).