C14H18N4O2S — CID 106069321
2-[(cyclopropylamino)methyl]-N-(1H-imidazol-2-ylmethyl)benzenesulfonamide (PubChem CID 106069321) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is 2-[(cyclopropylamino)methyl]-N-(1H-imidazol-2-ylmethyl)benzenesulfonamide.
| Compound Name | 2-[(cyclopropylamino)methyl]-N-(1H-imidazol-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106069321 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-[(cyclopropylamino)methyl]-N-(1H-imidazol-2-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ncc[nH]1)c1ccccc1CNC1CC1 |
| InChI | InChI=1S/C14H18N4O2S/c19-21(20,18-10-14-15-7-8-16-14)13-4-2-1-3-11(13)9-17-12-5-6-12/h1-4,7-8,12,17-18H,5-6,9-10H2,(H,15,16) |
| InChIKey | MODOLRDPHPYMQL-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |