About (4S,7aR)-4-hydroxy-4,7a-dihydrofuro[2,3-b]pyran-2-one
(4S,7aR)-4-hydroxy-4,7a-dihydrofuro[2,3-b]pyran-2-one (PubChem CID 10606969) has the molecular formula C7H6O4
and a molecular weight of 154.12 g/mol. Its IUPAC name is (4S,7aR)-4-hydroxy-4,7a-dihydrofuro[2,3-b]pyran-2-one.
Analyze (4S,7aR)-4-hydroxy-4,7a-dihydrofuro[2,3-b]pyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,7aR)-4-hydroxy-4,7a-dihydrofuro[2,3-b]pyran-2-one?
The IUPAC name of (4S,7aR)-4-hydroxy-4,7a-dihydrofuro[2,3-b]pyran-2-one (CID 10606969) is (4S,7aR)-4-hydroxy-4,7a-dihydrofuro[2,3-b]pyran-2-one.
What is the SMILES notation for (4S,7aR)-4-hydroxy-4,7a-dihydrofuro[2,3-b]pyran-2-one?
The canonical SMILES for (4S,7aR)-4-hydroxy-4,7a-dihydrofuro[2,3-b]pyran-2-one is O=C1C=C2[C@H](OC=C[C@@H]2O)O1.
What is the InChIKey of (4S,7aR)-4-hydroxy-4,7a-dihydrofuro[2,3-b]pyran-2-one?
The InChIKey is IONMZUYDQDQPGO-CAHLUQPWSA-N. The full InChI is InChI=1S/C7H6O4/c8-5-1-2-10-7-4(5)3-6(9)11-7/h1-3,5,7-8H/t5-,7+/m0/s1.
What are the key properties of (4S,7aR)-4-hydroxy-4,7a-dihydrofuro[2,3-b]pyran-2-one?
(4S,7aR)-4-hydroxy-4,7a-dihydrofuro[2,3-b]pyran-2-one has a molecular weight of 154.12 g/mol, XLogP of -0.30, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,7aR)-4-hydroxy-4,7a-dihydrofuro[2,3-b]pyran-2-one is sourced from PubChem (CID 10606969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).