C9H14O2 — CID 10606981
(3R,4R,5S)-4-methyloct-1-en-7-yne-3,5-diol (PubChem CID 10606981) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is (3R,4R,5S)-4-methyloct-1-en-7-yne-3,5-diol.
| Compound Name | (3R,4R,5S)-4-methyloct-1-en-7-yne-3,5-diol |
|---|---|
| PubChem CID | 10606981 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (3R,4R,5S)-4-methyloct-1-en-7-yne-3,5-diol |
| SMILES | C#CC[C@H](O)[C@@H](C)[C@H](O)C=C |
| InChI | InChI=1S/C9H14O2/c1-4-6-9(11)7(3)8(10)5-2/h1,5,7-11H,2,6H2,3H3/t7-,8+,9-/m0/s1 |
| InChIKey | QJLPSSSPXITMCC-YIZRAAEISA-N |
| XLogP | 0.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|