C14H22FN3O2S — CID 106070511
N-(3-fluoro-5-methylphenyl)-4-(methylaminomethyl)piperidine-1-sulfonamide (PubChem CID 106070511) has the molecular formula C14H22FN3O2S and a molecular weight of 315.41 g/mol. Its IUPAC name is N-(3-fluoro-5-methylphenyl)-4-(methylaminomethyl)piperidine-1-sulfonamide.
| Compound Name | N-(3-fluoro-5-methylphenyl)-4-(methylaminomethyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106070511 |
| Molecular Formula | C14H22FN3O2S |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-(3-fluoro-5-methylphenyl)-4-(methylaminomethyl)piperidine-1-sulfonamide |
| SMILES | CNCC1CCN(S(=O)(=O)Nc2cc(C)cc(F)c2)CC1 |
| InChI | InChI=1S/C14H22FN3O2S/c1-11-7-13(15)9-14(8-11)17-21(19,20)18-5-3-12(4-6-18)10-16-2/h7-9,12,16-17H,3-6,10H2,1-2H3 |
| InChIKey | SASRXAWVODIHGZ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |