About 2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-1,1-dimethylcyclopentane
2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-1,1-dimethylcyclopentane (PubChem CID 106071113) has the molecular formula C13H29N3O2S
and a molecular weight of 291.46 g/mol. Its IUPAC name is 2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-1,1-dimethylcyclopentane.
Molecular Properties
| Compound Name | 2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-1,1-dimethylcyclopentane |
| PubChem CID | 106071113 |
| Molecular Formula | C13H29N3O2S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-1,1-dimethylcyclopentane |
| SMILES | CCNCCCN(C)S(=O)(=O)NC1CCCC1(C)C |
| InChI | InChI=1S/C13H29N3O2S/c1-5-14-10-7-11-16(4)19(17,18)15-12-8-6-9-13(12,2)3/h12,14-15H,5-11H2,1-4H3 |
| InChIKey | CUKXSZXEXKVSPS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-1,1-dimethylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-1,1-dimethylcyclopentane?
The IUPAC name of 2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-1,1-dimethylcyclopentane (CID 106071113) is 2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-1,1-dimethylcyclopentane.
What is the SMILES notation for 2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-1,1-dimethylcyclopentane?
The canonical SMILES for 2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-1,1-dimethylcyclopentane is CCNCCCN(C)S(=O)(=O)NC1CCCC1(C)C.
What is the InChIKey of 2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-1,1-dimethylcyclopentane?
The InChIKey is CUKXSZXEXKVSPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29N3O2S/c1-5-14-10-7-11-16(4)19(17,18)15-12-8-6-9-13(12,2)3/h12,14-15H,5-11H2,1-4H3.
What are the key properties of 2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-1,1-dimethylcyclopentane?
2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-1,1-dimethylcyclopentane has a molecular weight of 291.46 g/mol, XLogP of 1.33, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(ethylamino)propyl-methylsulfamoyl]amino]-1,1-dimethylcyclopentane is sourced from PubChem (CID 106071113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).