C12H14FIN4O2S — CID 106071507
N-(4-fluoro-2-iodophenyl)-1-[2-(methylamino)ethyl]pyrazole-4-sulfonamide (PubChem CID 106071507) has the molecular formula C12H14FIN4O2S and a molecular weight of 424.24 g/mol. Its IUPAC name is N-(4-fluoro-2-iodophenyl)-1-[2-(methylamino)ethyl]pyrazole-4-sulfonamide.
| Compound Name | N-(4-fluoro-2-iodophenyl)-1-[2-(methylamino)ethyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106071507 |
| Molecular Formula | C12H14FIN4O2S |
| Molecular Weight | 424.24 g/mol |
| Exact Mass | 423.99 |
| IUPAC Name | N-(4-fluoro-2-iodophenyl)-1-[2-(methylamino)ethyl]pyrazole-4-sulfonamide |
| SMILES | CNCCn1cc(S(=O)(=O)Nc2ccc(F)cc2I)cn1 |
| InChI | InChI=1S/C12H14FIN4O2S/c1-15-4-5-18-8-10(7-16-18)21(19,20)17-12-3-2-9(13)6-11(12)14/h2-3,6-8,15,17H,4-5H2,1H3 |
| InChIKey | JIKIOILPYFCQCD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|