C14H22N2O2S3 — CID 106071767
5-[(cyclopropylamino)methyl]-4-methyl-N-(thiolan-2-ylmethyl)thiophene-2-sulfonamide (PubChem CID 106071767) has the molecular formula C14H22N2O2S3 and a molecular weight of 346.54 g/mol. Its IUPAC name is 5-[(cyclopropylamino)methyl]-4-methyl-N-(thiolan-2-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | 5-[(cyclopropylamino)methyl]-4-methyl-N-(thiolan-2-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106071767 |
| Molecular Formula | C14H22N2O2S3 |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 5-[(cyclopropylamino)methyl]-4-methyl-N-(thiolan-2-ylmethyl)thiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCC2CCCS2)sc1CNC1CC1 |
| InChI | InChI=1S/C14H22N2O2S3/c1-10-7-14(20-13(10)9-15-11-4-5-11)21(17,18)16-8-12-3-2-6-19-12/h7,11-12,15-16H,2-6,8-9H2,1H3 |
| InChIKey | WBRYWTWALYRNKH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |