C12H22N4O3S — CID 106072521
5-methyl-N-(oxolan-3-yl)-3-[(propan-2-ylamino)methyl]-1H-pyrazole-4-sulfonamide (PubChem CID 106072521) has the molecular formula C12H22N4O3S and a molecular weight of 302.40 g/mol. Its IUPAC name is 5-methyl-N-(oxolan-3-yl)-3-[(propan-2-ylamino)methyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-methyl-N-(oxolan-3-yl)-3-[(propan-2-ylamino)methyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106072521 |
| Molecular Formula | C12H22N4O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 5-methyl-N-(oxolan-3-yl)-3-[(propan-2-ylamino)methyl]-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]nc(CNC(C)C)c1S(=O)(=O)NC1CCOC1 |
| InChI | InChI=1S/C12H22N4O3S/c1-8(2)13-6-11-12(9(3)14-15-11)20(17,18)16-10-4-5-19-7-10/h8,10,13,16H,4-7H2,1-3H3,(H,14,15) |
| InChIKey | XKRYJVDRHQAHHF-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |