C14H18BrN3O2S — CID 106073387
5-(aminomethyl)-N-(4-bromo-2-ethylphenyl)-1-methylpyrrole-3-sulfonamide (PubChem CID 106073387) has the molecular formula C14H18BrN3O2S and a molecular weight of 372.29 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(4-bromo-2-ethylphenyl)-1-methylpyrrole-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(4-bromo-2-ethylphenyl)-1-methylpyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106073387 |
| Molecular Formula | C14H18BrN3O2S |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 5-(aminomethyl)-N-(4-bromo-2-ethylphenyl)-1-methylpyrrole-3-sulfonamide |
| SMILES | CCc1cc(Br)ccc1NS(=O)(=O)c1cc(CN)n(C)c1 |
| InChI | InChI=1S/C14H18BrN3O2S/c1-3-10-6-11(15)4-5-14(10)17-21(19,20)13-7-12(8-16)18(2)9-13/h4-7,9,17H,3,8,16H2,1-2H3 |
| InChIKey | ACJASIWRDHAYKB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |