C11H9Br2ClN2O2S2 — CID 106073516
5-(aminomethyl)-2-bromo-N-(2-bromo-4-chlorophenyl)thiophene-3-sulfonamide (PubChem CID 106073516) has the molecular formula C11H9Br2ClN2O2S2 and a molecular weight of 460.60 g/mol. Its IUPAC name is 5-(aminomethyl)-2-bromo-N-(2-bromo-4-chlorophenyl)thiophene-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-2-bromo-N-(2-bromo-4-chlorophenyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106073516 |
| Molecular Formula | C11H9Br2ClN2O2S2 |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 457.82 |
| IUPAC Name | 5-(aminomethyl)-2-bromo-N-(2-bromo-4-chlorophenyl)thiophene-3-sulfonamide |
| SMILES | NCc1cc(S(=O)(=O)Nc2ccc(Cl)cc2Br)c(Br)s1 |
| InChI | InChI=1S/C11H9Br2ClN2O2S2/c12-8-3-6(14)1-2-9(8)16-20(17,18)10-4-7(5-15)19-11(10)13/h1-4,16H,5,15H2 |
| InChIKey | JYUFJTBAOGZZPX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |