C13H19N5O2S — CID 106073945
N-[3-(dimethylamino)phenyl]-4-(methylaminomethyl)-1H-pyrazole-5-sulfonamide (PubChem CID 106073945) has the molecular formula C13H19N5O2S and a molecular weight of 309.40 g/mol. Its IUPAC name is N-[3-(dimethylamino)phenyl]-4-(methylaminomethyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-[3-(dimethylamino)phenyl]-4-(methylaminomethyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106073945 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-[3-(dimethylamino)phenyl]-4-(methylaminomethyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CNCc1cn[nH]c1S(=O)(=O)Nc1cccc(N(C)C)c1 |
| InChI | InChI=1S/C13H19N5O2S/c1-14-8-10-9-15-16-13(10)21(19,20)17-11-5-4-6-12(7-11)18(2)3/h4-7,9,14,17H,8H2,1-3H3,(H,15,16) |
| InChIKey | RCSHYONTCCRRLY-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |